C23H33N5O7 — CID 175196938
[1-[[5-(carbamoylamino)-1-[4-(hydroxymethyl)-3-(prop-2-ynoxymethyl)anilino]-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl] carbamate (PubChem CID 175196938) has the molecular formula C23H33N5O7 and a molecular weight of 491.55 g/mol. Its IUPAC name is [1-[[5-(carbamoylamino)-1-[4-(hydroxymethyl)-3-(prop-2-ynoxymethyl)anilino]-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl] carbamate.
| Compound Name | [1-[[5-(carbamoylamino)-1-[4-(hydroxymethyl)-3-(prop-2-ynoxymethyl)anilino]-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl] carbamate |
|---|---|
| PubChem CID | 175196938 |
| Molecular Formula | C23H33N5O7 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | [1-[[5-(carbamoylamino)-1-[4-(hydroxymethyl)-3-(prop-2-ynoxymethyl)anilino]-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl] carbamate |
| SMILES | C#CCOCc1cc(NC(=O)C(CCCNC(N)=O)NC(=O)C(OC(N)=O)C(C)C)ccc1CO |
| InChI | InChI=1S/C23H33N5O7/c1-4-10-34-13-16-11-17(8-7-15(16)12-29)27-20(30)18(6-5-9-26-22(24)32)28-21(31)19(14(2)3)35-23(25)33/h1,7-8,11,14,18-19,29H,5-6,9-10,12-13H2,2-3H3,(H2,25,33)(H,27,30)(H,28,31)(H3,24,26,32) |
| InChIKey | MVUTWHMTMKJFHU-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 195.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|