C25H35N7O9 — CID 155320824
[1-[[5-(carbamoylamino)-1-[4-(hydroxymethyl)-3-[[2-(prop-2-ynoxycarbonylamino)acetyl]amino]anilino]-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamic acid (PubChem CID 155320824) has the molecular formula C25H35N7O9 and a molecular weight of 577.60 g/mol. Its IUPAC name is [1-[[5-(carbamoylamino)-1-[4-(hydroxymethyl)-3-[[2-(prop-2-ynoxycarbonylamino)acetyl]amino]anilino]-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamic acid.
| Compound Name | [1-[[5-(carbamoylamino)-1-[4-(hydroxymethyl)-3-[[2-(prop-2-ynoxycarbonylamino)acetyl]amino]anilino]-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 155320824 |
| Molecular Formula | C25H35N7O9 |
| Molecular Weight | 577.60 g/mol |
| Exact Mass | 577.25 |
| IUPAC Name | [1-[[5-(carbamoylamino)-1-[4-(hydroxymethyl)-3-[[2-(prop-2-ynoxycarbonylamino)acetyl]amino]anilino]-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamic acid |
| SMILES | C#CCOC(=O)NCC(=O)Nc1cc(NC(=O)C(CCCNC(N)=O)NC(=O)C(NC(=O)O)C(C)C)ccc1CO |
| InChI | InChI=1S/C25H35N7O9/c1-4-10-41-25(40)28-12-19(34)30-18-11-16(8-7-15(18)13-33)29-21(35)17(6-5-9-27-23(26)37)31-22(36)20(14(2)3)32-24(38)39/h1,7-8,11,14,17,20,32-33H,5-6,9-10,12-13H2,2-3H3,(H,28,40)(H,29,35)(H,30,34)(H,31,36)(H,38,39)(H3,26,27,37) |
| InChIKey | JHFFINXVJPXHDR-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 250.31 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.60 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|