About 1-ethenylimidazole;2-hydroxyethyl 2-methylprop-2-enoate
1-ethenylimidazole;2-hydroxyethyl 2-methylprop-2-enoate (PubChem CID 70536973) has the molecular formula C11H16N2O3
and a molecular weight of 224.26 g/mol. Its IUPAC name is 1-ethenylimidazole;2-hydroxyethyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | 1-ethenylimidazole;2-hydroxyethyl 2-methylprop-2-enoate |
| PubChem CID | 70536973 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 1-ethenylimidazole;2-hydroxyethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCO.C=Cn1ccnc1 |
| InChI | InChI=1S/C6H10O3.C5H6N2/c1-5(2)6(8)9-4-3-7;1-2-7-4-3-6-5-7/h7H,1,3-4H2,2H3;2-5H,1H2 |
| InChIKey | XPUQOHPTHMUKFU-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenylimidazole;2-hydroxyethyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenylimidazole;2-hydroxyethyl 2-methylprop-2-enoate?
The IUPAC name of 1-ethenylimidazole;2-hydroxyethyl 2-methylprop-2-enoate (CID 70536973) is 1-ethenylimidazole;2-hydroxyethyl 2-methylprop-2-enoate.
What is the SMILES notation for 1-ethenylimidazole;2-hydroxyethyl 2-methylprop-2-enoate?
The canonical SMILES for 1-ethenylimidazole;2-hydroxyethyl 2-methylprop-2-enoate is C=C(C)C(=O)OCCO.C=Cn1ccnc1.
What is the InChIKey of 1-ethenylimidazole;2-hydroxyethyl 2-methylprop-2-enoate?
The InChIKey is XPUQOHPTHMUKFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3.C5H6N2/c1-5(2)6(8)9-4-3-7;1-2-7-4-3-6-5-7/h7H,1,3-4H2,2H3;2-5H,1H2.
What are the key properties of 1-ethenylimidazole;2-hydroxyethyl 2-methylprop-2-enoate?
1-ethenylimidazole;2-hydroxyethyl 2-methylprop-2-enoate has a molecular weight of 224.26 g/mol, XLogP of 1.08, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenylimidazole;2-hydroxyethyl 2-methylprop-2-enoate is sourced from PubChem (CID 70536973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).