C11H16N2O3 — CID 139906170
1-ethenylimidazole;1-hydroxyethyl 2-methylprop-2-enoate (PubChem CID 139906170) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is 1-ethenylimidazole;1-hydroxyethyl 2-methylprop-2-enoate.
| Compound Name | 1-ethenylimidazole;1-hydroxyethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139906170 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 1-ethenylimidazole;1-hydroxyethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)O.C=Cn1ccnc1 |
| InChI | InChI=1S/C6H10O3.C5H6N2/c1-4(2)6(8)9-5(3)7;1-2-7-4-3-6-5-7/h5,7H,1H2,2-3H3;2-5H,1H2 |
| InChIKey | WYFFRXRMXLOZHX-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|