C10H16O5 — CID 87377367
but-3-enoic acid;1-hydroxyethyl 2-methylprop-2-enoate (PubChem CID 87377367) has the molecular formula C10H16O5 and a molecular weight of 216.23 g/mol. Its IUPAC name is but-3-enoic acid;1-hydroxyethyl 2-methylprop-2-enoate.
| Compound Name | but-3-enoic acid;1-hydroxyethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87377367 |
| Molecular Formula | C10H16O5 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | but-3-enoic acid;1-hydroxyethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)O.C=CCC(=O)O |
| InChI | InChI=1S/C6H10O3.C4H6O2/c1-4(2)6(8)9-5(3)7;1-2-3-4(5)6/h5,7H,1H2,2-3H3;2H,1,3H2,(H,5,6) |
| InChIKey | OLFPIEKZHJAFKN-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|