C24H43NO7 — CID 88730169
butyl 2-methylprop-2-enoate;1-(diethylamino)ethyl 2-methylprop-2-enoate;1-hydroxyethyl 2-methylprop-2-enoate (PubChem CID 88730169) has the molecular formula C24H43NO7 and a molecular weight of 457.61 g/mol. Its IUPAC name is butyl 2-methylprop-2-enoate;1-(diethylamino)ethyl 2-methylprop-2-enoate;1-hydroxyethyl 2-methylprop-2-enoate.
| Compound Name | butyl 2-methylprop-2-enoate;1-(diethylamino)ethyl 2-methylprop-2-enoate;1-hydroxyethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88730169 |
| Molecular Formula | C24H43NO7 |
| Molecular Weight | 457.61 g/mol |
| Exact Mass | 457.30 |
| IUPAC Name | butyl 2-methylprop-2-enoate;1-(diethylamino)ethyl 2-methylprop-2-enoate;1-hydroxyethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)N(CC)CC.C=C(C)C(=O)OC(C)O.C=C(C)C(=O)OCCCC |
| InChI | InChI=1S/C10H19NO2.C8H14O2.C6H10O3/c1-6-11(7-2)9(5)13-10(12)8(3)4;1-4-5-6-10-8(9)7(2)3;1-4(2)6(8)9-5(3)7/h9H,3,6-7H2,1-2,4-5H3;2,4-6H2,1,3H3;5,7H,1H2,2-3H3 |
| InChIKey | OLTYBTHUSCHUBT-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.61 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|