About 3-imidazol-1-ylhexan-2-yl 2-methylprop-2-enoate;hydrobromide
3-imidazol-1-ylhexan-2-yl 2-methylprop-2-enoate;hydrobromide (PubChem CID 174774166) has the molecular formula C13H21BrN2O2
and a molecular weight of 317.23 g/mol. Its IUPAC name is 3-imidazol-1-ylhexan-2-yl 2-methylprop-2-enoate;hydrobromide.
Molecular Properties
| Compound Name | 3-imidazol-1-ylhexan-2-yl 2-methylprop-2-enoate;hydrobromide |
| PubChem CID | 174774166 |
| Molecular Formula | C13H21BrN2O2 |
| Molecular Weight | 317.23 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 3-imidazol-1-ylhexan-2-yl 2-methylprop-2-enoate;hydrobromide |
| SMILES | Br.C=C(C)C(=O)OC(C)C(CCC)n1ccnc1 |
| InChI | InChI=1S/C13H20N2O2.BrH/c1-5-6-12(15-8-7-14-9-15)11(4)17-13(16)10(2)3;/h7-9,11-12H,2,5-6H2,1,3-4H3;1H |
| InChIKey | NFRPHFBJWRQXKU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.23 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-imidazol-1-ylhexan-2-yl 2-methylprop-2-enoate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-imidazol-1-ylhexan-2-yl 2-methylprop-2-enoate;hydrobromide?
The IUPAC name of 3-imidazol-1-ylhexan-2-yl 2-methylprop-2-enoate;hydrobromide (CID 174774166) is 3-imidazol-1-ylhexan-2-yl 2-methylprop-2-enoate;hydrobromide.
What is the SMILES notation for 3-imidazol-1-ylhexan-2-yl 2-methylprop-2-enoate;hydrobromide?
The canonical SMILES for 3-imidazol-1-ylhexan-2-yl 2-methylprop-2-enoate;hydrobromide is Br.C=C(C)C(=O)OC(C)C(CCC)n1ccnc1.
What is the InChIKey of 3-imidazol-1-ylhexan-2-yl 2-methylprop-2-enoate;hydrobromide?
The InChIKey is NFRPHFBJWRQXKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O2.BrH/c1-5-6-12(15-8-7-14-9-15)11(4)17-13(16)10(2)3;/h7-9,11-12H,2,5-6H2,1,3-4H3;1H.
What are the key properties of 3-imidazol-1-ylhexan-2-yl 2-methylprop-2-enoate;hydrobromide?
3-imidazol-1-ylhexan-2-yl 2-methylprop-2-enoate;hydrobromide has a molecular weight of 317.23 g/mol, XLogP of 3.31, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-imidazol-1-ylhexan-2-yl 2-methylprop-2-enoate;hydrobromide is sourced from PubChem (CID 174774166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).