C13H23N3O2 — CID 115410108
3-imidazol-1-yl-N-(2-methylpropoxy)hexanamide (PubChem CID 115410108) has the molecular formula C13H23N3O2 and a molecular weight of 253.35 g/mol. Its IUPAC name is 3-imidazol-1-yl-N-(2-methylpropoxy)hexanamide.
| Compound Name | 3-imidazol-1-yl-N-(2-methylpropoxy)hexanamide |
|---|---|
| PubChem CID | 115410108 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 3-imidazol-1-yl-N-(2-methylpropoxy)hexanamide |
| SMILES | CCCC(CC(=O)NOCC(C)C)n1ccnc1 |
| InChI | InChI=1S/C13H23N3O2/c1-4-5-12(16-7-6-14-10-16)8-13(17)15-18-9-11(2)3/h6-7,10-12H,4-5,8-9H2,1-3H3,(H,15,17) |
| InChIKey | HFXFCIPIIBBRJC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|