C15H27N3O2 — CID 106179981
N-(3-hydroxy-2,3-dimethylbutan-2-yl)-3-imidazol-1-ylhexanamide (PubChem CID 106179981) has the molecular formula C15H27N3O2 and a molecular weight of 281.40 g/mol. Its IUPAC name is N-(3-hydroxy-2,3-dimethylbutan-2-yl)-3-imidazol-1-ylhexanamide.
| Compound Name | N-(3-hydroxy-2,3-dimethylbutan-2-yl)-3-imidazol-1-ylhexanamide |
|---|---|
| PubChem CID | 106179981 |
| Molecular Formula | C15H27N3O2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | N-(3-hydroxy-2,3-dimethylbutan-2-yl)-3-imidazol-1-ylhexanamide |
| SMILES | CCCC(CC(=O)NC(C)(C)C(C)(C)O)n1ccnc1 |
| InChI | InChI=1S/C15H27N3O2/c1-6-7-12(18-9-8-16-11-18)10-13(19)17-14(2,3)15(4,5)20/h8-9,11-12,20H,6-7,10H2,1-5H3,(H,17,19) |
| InChIKey | WBRKBBWXFUSNPL-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |