About 1-imidazol-1-ylpropyl acetate
1-imidazol-1-ylpropyl acetate (PubChem CID 126696666) has the molecular formula C8H12N2O2
and a molecular weight of 168.20 g/mol. Its IUPAC name is 1-imidazol-1-ylpropyl acetate.
Molecular Properties
| Compound Name | 1-imidazol-1-ylpropyl acetate |
| PubChem CID | 126696666 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 1-imidazol-1-ylpropyl acetate |
| SMILES | CCC(OC(C)=O)n1ccnc1 |
| InChI | InChI=1S/C8H12N2O2/c1-3-8(12-7(2)11)10-5-4-9-6-10/h4-6,8H,3H2,1-2H3 |
| InChIKey | NDXZYNZBIMYZCK-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-imidazol-1-ylpropyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-imidazol-1-ylpropyl acetate?
The IUPAC name of 1-imidazol-1-ylpropyl acetate (CID 126696666) is 1-imidazol-1-ylpropyl acetate.
What is the SMILES notation for 1-imidazol-1-ylpropyl acetate?
The canonical SMILES for 1-imidazol-1-ylpropyl acetate is CCC(OC(C)=O)n1ccnc1.
What is the InChIKey of 1-imidazol-1-ylpropyl acetate?
The InChIKey is NDXZYNZBIMYZCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2/c1-3-8(12-7(2)11)10-5-4-9-6-10/h4-6,8H,3H2,1-2H3.
What are the key properties of 1-imidazol-1-ylpropyl acetate?
1-imidazol-1-ylpropyl acetate has a molecular weight of 168.20 g/mol, XLogP of 1.35, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-imidazol-1-ylpropyl acetate is sourced from PubChem (CID 126696666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).