C10H14N2O2 — CID 165036024
(3S)-3-imidazol-1-ylheptane-2,6-dione (PubChem CID 165036024) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is (3S)-3-imidazol-1-ylheptane-2,6-dione.
| Compound Name | (3S)-3-imidazol-1-ylheptane-2,6-dione |
|---|---|
| PubChem CID | 165036024 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | (3S)-3-imidazol-1-ylheptane-2,6-dione |
| SMILES | CC(=O)CC[C@@H](C(C)=O)n1ccnc1 |
| InChI | InChI=1S/C10H14N2O2/c1-8(13)3-4-10(9(2)14)12-6-5-11-7-12/h5-7,10H,3-4H2,1-2H3/t10-/m0/s1 |
| InChIKey | BFKOXPDFTFVRGF-JTQLQIEISA-N |
| XLogP | 1.38 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |