About 1-imidazol-1-ylethanol
1-imidazol-1-ylethanol (PubChem CID 18366448) has the molecular formula C5H8N2O
and a molecular weight of 112.13 g/mol. Its IUPAC name is 1-imidazol-1-ylethanol.
Molecular Properties
| Compound Name | 1-imidazol-1-ylethanol |
| PubChem CID | 18366448 |
| Molecular Formula | C5H8N2O |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.06 |
| IUPAC Name | 1-imidazol-1-ylethanol |
| SMILES | CC(O)n1ccnc1 |
| InChI | InChI=1S/C5H8N2O/c1-5(8)7-3-2-6-4-7/h2-5,8H,1H3 |
| InChIKey | UEKUFHQHXAAMLQ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-imidazol-1-ylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-imidazol-1-ylethanol?
The IUPAC name of 1-imidazol-1-ylethanol (CID 18366448) is 1-imidazol-1-ylethanol.
What is the SMILES notation for 1-imidazol-1-ylethanol?
The canonical SMILES for 1-imidazol-1-ylethanol is CC(O)n1ccnc1.
What is the InChIKey of 1-imidazol-1-ylethanol?
The InChIKey is UEKUFHQHXAAMLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O/c1-5(8)7-3-2-6-4-7/h2-5,8H,1H3.
What are the key properties of 1-imidazol-1-ylethanol?
1-imidazol-1-ylethanol has a molecular weight of 112.13 g/mol, XLogP of 0.39, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-imidazol-1-ylethanol is sourced from PubChem (CID 18366448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).