About 1-imidazol-1-yl-N,N-dimethylethanamine
1-imidazol-1-yl-N,N-dimethylethanamine (PubChem CID 123720804) has the molecular formula C7H13N3
and a molecular weight of 139.20 g/mol. Its IUPAC name is 1-imidazol-1-yl-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 1-imidazol-1-yl-N,N-dimethylethanamine |
| PubChem CID | 123720804 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | 1-imidazol-1-yl-N,N-dimethylethanamine |
| SMILES | CC(N(C)C)n1ccnc1 |
| InChI | InChI=1S/C7H13N3/c1-7(9(2)3)10-5-4-8-6-10/h4-7H,1-3H3 |
| InChIKey | KRUSSPMJTXOCAM-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-imidazol-1-yl-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-imidazol-1-yl-N,N-dimethylethanamine?
The IUPAC name of 1-imidazol-1-yl-N,N-dimethylethanamine (CID 123720804) is 1-imidazol-1-yl-N,N-dimethylethanamine.
What is the SMILES notation for 1-imidazol-1-yl-N,N-dimethylethanamine?
The canonical SMILES for 1-imidazol-1-yl-N,N-dimethylethanamine is CC(N(C)C)n1ccnc1.
What is the InChIKey of 1-imidazol-1-yl-N,N-dimethylethanamine?
The InChIKey is KRUSSPMJTXOCAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3/c1-7(9(2)3)10-5-4-8-6-10/h4-7H,1-3H3.
What are the key properties of 1-imidazol-1-yl-N,N-dimethylethanamine?
1-imidazol-1-yl-N,N-dimethylethanamine has a molecular weight of 139.20 g/mol, XLogP of 0.96, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-imidazol-1-yl-N,N-dimethylethanamine is sourced from PubChem (CID 123720804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).