About ethane;methane;1-propan-2-ylimidazole
ethane;methane;1-propan-2-ylimidazole (PubChem CID 159501500) has the molecular formula C9H20N2
and a molecular weight of 156.27 g/mol. Its IUPAC name is ethane;methane;1-propan-2-ylimidazole.
Molecular Properties
| Compound Name | ethane;methane;1-propan-2-ylimidazole |
| PubChem CID | 159501500 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | ethane;methane;1-propan-2-ylimidazole |
| SMILES | C.CC.CC(C)n1ccnc1 |
| InChI | InChI=1S/C6H10N2.C2H6.CH4/c1-6(2)8-4-3-7-5-8;1-2;/h3-6H,1-2H3;1-2H3;1H4 |
| InChIKey | LZLBTPHFOUXSIE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;methane;1-propan-2-ylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methane;1-propan-2-ylimidazole?
The IUPAC name of ethane;methane;1-propan-2-ylimidazole (CID 159501500) is ethane;methane;1-propan-2-ylimidazole.
What is the SMILES notation for ethane;methane;1-propan-2-ylimidazole?
The canonical SMILES for ethane;methane;1-propan-2-ylimidazole is C.CC.CC(C)n1ccnc1.
What is the InChIKey of ethane;methane;1-propan-2-ylimidazole?
The InChIKey is LZLBTPHFOUXSIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2.C2H6.CH4/c1-6(2)8-4-3-7-5-8;1-2;/h3-6H,1-2H3;1-2H3;1H4.
What are the key properties of ethane;methane;1-propan-2-ylimidazole?
ethane;methane;1-propan-2-ylimidazole has a molecular weight of 156.27 g/mol, XLogP of 3.13, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methane;1-propan-2-ylimidazole is sourced from PubChem (CID 159501500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).