About boric acid;1-but-3-en-2-ylimidazole
boric acid;1-but-3-en-2-ylimidazole (PubChem CID 174786632) has the molecular formula C7H13BN2O3
and a molecular weight of 184.00 g/mol. Its IUPAC name is boric acid;1-but-3-en-2-ylimidazole.
Molecular Properties
| Compound Name | boric acid;1-but-3-en-2-ylimidazole |
| PubChem CID | 174786632 |
| Molecular Formula | C7H13BN2O3 |
| Molecular Weight | 184.00 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | boric acid;1-but-3-en-2-ylimidazole |
| SMILES | C=CC(C)n1ccnc1.OB(O)O |
| InChI | InChI=1S/C7H10N2.BH3O3/c1-3-7(2)9-5-4-8-6-9;2-1(3)4/h3-7H,1H2,2H3;2-4H |
| InChIKey | CYQGSPWDVAGFQJ-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.00 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze boric acid;1-but-3-en-2-ylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of boric acid;1-but-3-en-2-ylimidazole?
The IUPAC name of boric acid;1-but-3-en-2-ylimidazole (CID 174786632) is boric acid;1-but-3-en-2-ylimidazole.
What is the SMILES notation for boric acid;1-but-3-en-2-ylimidazole?
The canonical SMILES for boric acid;1-but-3-en-2-ylimidazole is C=CC(C)n1ccnc1.OB(O)O.
What is the InChIKey of boric acid;1-but-3-en-2-ylimidazole?
The InChIKey is CYQGSPWDVAGFQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2.BH3O3/c1-3-7(2)9-5-4-8-6-9;2-1(3)4/h3-7H,1H2,2H3;2-4H.
What are the key properties of boric acid;1-but-3-en-2-ylimidazole?
boric acid;1-but-3-en-2-ylimidazole has a molecular weight of 184.00 g/mol, XLogP of -0.42, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for boric acid;1-but-3-en-2-ylimidazole is sourced from PubChem (CID 174786632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).