About 1-butan-2-ylimidazole;3-methylsulfanylpropanoic acid
1-butan-2-ylimidazole;3-methylsulfanylpropanoic acid (PubChem CID 174844768) has the molecular formula C11H20N2O2S
and a molecular weight of 244.36 g/mol. Its IUPAC name is 1-butan-2-ylimidazole;3-methylsulfanylpropanoic acid.
Molecular Properties
| Compound Name | 1-butan-2-ylimidazole;3-methylsulfanylpropanoic acid |
| PubChem CID | 174844768 |
| Molecular Formula | C11H20N2O2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 1-butan-2-ylimidazole;3-methylsulfanylpropanoic acid |
| SMILES | CCC(C)n1ccnc1.CSCCC(=O)O |
| InChI | InChI=1S/C7H12N2.C4H8O2S/c1-3-7(2)9-5-4-8-6-9;1-7-3-2-4(5)6/h4-7H,3H2,1-2H3;2-3H2,1H3,(H,5,6) |
| InChIKey | GRJIOOCKLUWQPW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-butan-2-ylimidazole;3-methylsulfanylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butan-2-ylimidazole;3-methylsulfanylpropanoic acid?
The IUPAC name of 1-butan-2-ylimidazole;3-methylsulfanylpropanoic acid (CID 174844768) is 1-butan-2-ylimidazole;3-methylsulfanylpropanoic acid.
What is the SMILES notation for 1-butan-2-ylimidazole;3-methylsulfanylpropanoic acid?
The canonical SMILES for 1-butan-2-ylimidazole;3-methylsulfanylpropanoic acid is CCC(C)n1ccnc1.CSCCC(=O)O.
What is the InChIKey of 1-butan-2-ylimidazole;3-methylsulfanylpropanoic acid?
The InChIKey is GRJIOOCKLUWQPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2.C4H8O2S/c1-3-7(2)9-5-4-8-6-9;1-7-3-2-4(5)6/h4-7H,3H2,1-2H3;2-3H2,1H3,(H,5,6).
What are the key properties of 1-butan-2-ylimidazole;3-methylsulfanylpropanoic acid?
1-butan-2-ylimidazole;3-methylsulfanylpropanoic acid has a molecular weight of 244.36 g/mol, XLogP of 2.68, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butan-2-ylimidazole;3-methylsulfanylpropanoic acid is sourced from PubChem (CID 174844768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).