About carbonic acid;1-nonan-2-ylimidazole
carbonic acid;1-nonan-2-ylimidazole (PubChem CID 175092771) has the molecular formula C13H24N2O3
and a molecular weight of 256.35 g/mol. Its IUPAC name is carbonic acid;1-nonan-2-ylimidazole.
Molecular Properties
| Compound Name | carbonic acid;1-nonan-2-ylimidazole |
| PubChem CID | 175092771 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | carbonic acid;1-nonan-2-ylimidazole |
| SMILES | CCCCCCCC(C)n1ccnc1.O=C(O)O |
| InChI | InChI=1S/C12H22N2.CH2O3/c1-3-4-5-6-7-8-12(2)14-10-9-13-11-14;2-1(3)4/h9-12H,3-8H2,1-2H3;(H2,2,3,4) |
| InChIKey | MVQMVYYVENLICL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze carbonic acid;1-nonan-2-ylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonic acid;1-nonan-2-ylimidazole?
The IUPAC name of carbonic acid;1-nonan-2-ylimidazole (CID 175092771) is carbonic acid;1-nonan-2-ylimidazole.
What is the SMILES notation for carbonic acid;1-nonan-2-ylimidazole?
The canonical SMILES for carbonic acid;1-nonan-2-ylimidazole is CCCCCCCC(C)n1ccnc1.O=C(O)O.
What is the InChIKey of carbonic acid;1-nonan-2-ylimidazole?
The InChIKey is MVQMVYYVENLICL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2.CH2O3/c1-3-4-5-6-7-8-12(2)14-10-9-13-11-14;2-1(3)4/h9-12H,3-8H2,1-2H3;(H2,2,3,4).
What are the key properties of carbonic acid;1-nonan-2-ylimidazole?
carbonic acid;1-nonan-2-ylimidazole has a molecular weight of 256.35 g/mol, XLogP of 4.03, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;1-nonan-2-ylimidazole is sourced from PubChem (CID 175092771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).