About fluoromethane;1-heptan-2-ylimidazole
fluoromethane;1-heptan-2-ylimidazole (PubChem CID 174715360) has the molecular formula C11H21FN2
and a molecular weight of 200.30 g/mol. Its IUPAC name is fluoromethane;1-heptan-2-ylimidazole.
Molecular Properties
| Compound Name | fluoromethane;1-heptan-2-ylimidazole |
| PubChem CID | 174715360 |
| Molecular Formula | C11H21FN2 |
| Molecular Weight | 200.30 g/mol |
| Exact Mass | 200.17 |
| IUPAC Name | fluoromethane;1-heptan-2-ylimidazole |
| SMILES | CCCCCC(C)n1ccnc1.CF |
| InChI | InChI=1S/C10H18N2.CH3F/c1-3-4-5-6-10(2)12-8-7-11-9-12;1-2/h7-10H,3-6H2,1-2H3;1H3 |
| InChIKey | DQDREVNBLQEGEM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.30 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze fluoromethane;1-heptan-2-ylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoromethane;1-heptan-2-ylimidazole?
The IUPAC name of fluoromethane;1-heptan-2-ylimidazole (CID 174715360) is fluoromethane;1-heptan-2-ylimidazole.
What is the SMILES notation for fluoromethane;1-heptan-2-ylimidazole?
The canonical SMILES for fluoromethane;1-heptan-2-ylimidazole is CCCCCC(C)n1ccnc1.CF.
What is the InChIKey of fluoromethane;1-heptan-2-ylimidazole?
The InChIKey is DQDREVNBLQEGEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2.CH3F/c1-3-4-5-6-10(2)12-8-7-11-9-12;1-2/h7-10H,3-6H2,1-2H3;1H3.
What are the key properties of fluoromethane;1-heptan-2-ylimidazole?
fluoromethane;1-heptan-2-ylimidazole has a molecular weight of 200.30 g/mol, XLogP of 3.61, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for fluoromethane;1-heptan-2-ylimidazole is sourced from PubChem (CID 174715360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).