About formic acid;1-octan-2-ylimidazole
formic acid;1-octan-2-ylimidazole (PubChem CID 175596795) has the molecular formula C12H22N2O2
and a molecular weight of 226.32 g/mol. Its IUPAC name is formic acid;1-octan-2-ylimidazole.
Molecular Properties
| Compound Name | formic acid;1-octan-2-ylimidazole |
| PubChem CID | 175596795 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | formic acid;1-octan-2-ylimidazole |
| SMILES | CCCCCCC(C)n1ccnc1.O=CO |
| InChI | InChI=1S/C11H20N2.CH2O2/c1-3-4-5-6-7-11(2)13-9-8-12-10-13;2-1-3/h8-11H,3-7H2,1-2H3;1H,(H,2,3) |
| InChIKey | ZHXGXCIQZSFIHK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze formic acid;1-octan-2-ylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;1-octan-2-ylimidazole?
The IUPAC name of formic acid;1-octan-2-ylimidazole (CID 175596795) is formic acid;1-octan-2-ylimidazole.
What is the SMILES notation for formic acid;1-octan-2-ylimidazole?
The canonical SMILES for formic acid;1-octan-2-ylimidazole is CCCCCCC(C)n1ccnc1.O=CO.
What is the InChIKey of formic acid;1-octan-2-ylimidazole?
The InChIKey is ZHXGXCIQZSFIHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2.CH2O2/c1-3-4-5-6-7-11(2)13-9-8-12-10-13;2-1-3/h8-11H,3-7H2,1-2H3;1H,(H,2,3).
What are the key properties of formic acid;1-octan-2-ylimidazole?
formic acid;1-octan-2-ylimidazole has a molecular weight of 226.32 g/mol, XLogP of 3.12, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;1-octan-2-ylimidazole is sourced from PubChem (CID 175596795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).