C20H25N3O3 — CID 163265487
2-[[5-[1-(2,3-dimethylphenyl)ethyl]imidazole-1-carbonyl]amino]ethyl 2-methylprop-2-enoate (PubChem CID 163265487) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is 2-[[5-[1-(2,3-dimethylphenyl)ethyl]imidazole-1-carbonyl]amino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[5-[1-(2,3-dimethylphenyl)ethyl]imidazole-1-carbonyl]amino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 163265487 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 2-[[5-[1-(2,3-dimethylphenyl)ethyl]imidazole-1-carbonyl]amino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)n1cncc1C(C)c1cccc(C)c1C |
| InChI | InChI=1S/C20H25N3O3/c1-13(2)19(24)26-10-9-22-20(25)23-12-21-11-18(23)16(5)17-8-6-7-14(3)15(17)4/h6-8,11-12,16H,1,9-10H2,2-5H3,(H,22,25) |
| InChIKey | HJVSHJUHKNUOJA-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|