C11H14N4O3 — CID 66827300
2-(pyrimidin-2-ylcarbamoylamino)ethyl 2-methylprop-2-enoate (PubChem CID 66827300) has the molecular formula C11H14N4O3 and a molecular weight of 250.26 g/mol. Its IUPAC name is 2-(pyrimidin-2-ylcarbamoylamino)ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(pyrimidin-2-ylcarbamoylamino)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 66827300 |
| Molecular Formula | C11H14N4O3 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 2-(pyrimidin-2-ylcarbamoylamino)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)Nc1ncccn1 |
| InChI | InChI=1S/C11H14N4O3/c1-8(2)9(16)18-7-6-14-11(17)15-10-12-4-3-5-13-10/h3-5H,1,6-7H2,2H3,(H2,12,13,14,15,17) |
| InChIKey | MTTFSLDJMSDJKJ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|