C22H40N4O6Si — CID 158258560
2-[3-[dimethyl-[3-[2-(2-methylprop-2-enoyloxy)ethylcarbamoylamino]propyl]silyl]propylcarbamoylamino]ethyl 2-methylprop-2-enoate (PubChem CID 158258560) has the molecular formula C22H40N4O6Si and a molecular weight of 484.67 g/mol. Its IUPAC name is 2-[3-[dimethyl-[3-[2-(2-methylprop-2-enoyloxy)ethylcarbamoylamino]propyl]silyl]propylcarbamoylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[3-[dimethyl-[3-[2-(2-methylprop-2-enoyloxy)ethylcarbamoylamino]propyl]silyl]propylcarbamoylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 158258560 |
| Molecular Formula | C22H40N4O6Si |
| Molecular Weight | 484.67 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | 2-[3-[dimethyl-[3-[2-(2-methylprop-2-enoyloxy)ethylcarbamoylamino]propyl]silyl]propylcarbamoylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)NCCC[Si](C)(C)CCCNC(=O)NCCOC(=O)C(=C)C |
| InChI | InChI=1S/C22H40N4O6Si/c1-17(2)19(27)31-13-11-25-21(29)23-9-7-15-33(5,6)16-8-10-24-22(30)26-12-14-32-20(28)18(3)4/h1,3,7-16H2,2,4-6H3,(H2,23,25,29)(H2,24,26,30) |
| InChIKey | AXAYPSRNFYINHZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.67 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|