C12H22N2O4 — CID 169159810
3-(3-methoxypropylcarbamoylamino)propyl 2-methylprop-2-enoate (PubChem CID 169159810) has the molecular formula C12H22N2O4 and a molecular weight of 258.32 g/mol. Its IUPAC name is 3-(3-methoxypropylcarbamoylamino)propyl 2-methylprop-2-enoate.
| Compound Name | 3-(3-methoxypropylcarbamoylamino)propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 169159810 |
| Molecular Formula | C12H22N2O4 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 3-(3-methoxypropylcarbamoylamino)propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCNC(=O)NCCCOC |
| InChI | InChI=1S/C12H22N2O4/c1-10(2)11(15)18-9-5-7-14-12(16)13-6-4-8-17-3/h1,4-9H2,2-3H3,(H2,13,14,16) |
| InChIKey | HLHCUAWOJMQVAE-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|