C17H33N2O5P — CID 174905152
2-(6-diethylphosphoryloxyhexylcarbamoylamino)ethyl 2-methylprop-2-enoate (PubChem CID 174905152) has the molecular formula C17H33N2O5P and a molecular weight of 376.43 g/mol. Its IUPAC name is 2-(6-diethylphosphoryloxyhexylcarbamoylamino)ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(6-diethylphosphoryloxyhexylcarbamoylamino)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 174905152 |
| Molecular Formula | C17H33N2O5P |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | 2-(6-diethylphosphoryloxyhexylcarbamoylamino)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)NCCCCCCOP(=O)(CC)CC |
| InChI | InChI=1S/C17H33N2O5P/c1-5-25(22,6-2)24-13-10-8-7-9-11-18-17(21)19-12-14-23-16(20)15(3)4/h3,5-14H2,1-2,4H3,(H2,18,19,21) |
| InChIKey | IGMQNHNUGSYKNF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|