About 1-imidazol-1-ylethanone;2H-tetrazole
1-imidazol-1-ylethanone;2H-tetrazole (PubChem CID 142181644) has the molecular formula C6H8N6O
and a molecular weight of 180.17 g/mol. Its IUPAC name is 1-imidazol-1-ylethanone;2H-tetrazole.
Molecular Properties
| Compound Name | 1-imidazol-1-ylethanone;2H-tetrazole |
| PubChem CID | 142181644 |
| Molecular Formula | C6H8N6O |
| Molecular Weight | 180.17 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 1-imidazol-1-ylethanone;2H-tetrazole |
| SMILES | CC(=O)n1ccnc1.c1nn[nH]n1 |
| InChI | InChI=1S/C5H6N2O.CH2N4/c1-5(8)7-3-2-6-4-7;1-2-4-5-3-1/h2-4H,1H3;1H,(H,2,3,4,5) |
| InChIKey | HIUMOIZANXARLN-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.17 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-imidazol-1-ylethanone;2H-tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-imidazol-1-ylethanone;2H-tetrazole?
The IUPAC name of 1-imidazol-1-ylethanone;2H-tetrazole (CID 142181644) is 1-imidazol-1-ylethanone;2H-tetrazole.
What is the SMILES notation for 1-imidazol-1-ylethanone;2H-tetrazole?
The canonical SMILES for 1-imidazol-1-ylethanone;2H-tetrazole is CC(=O)n1ccnc1.c1nn[nH]n1.
What is the InChIKey of 1-imidazol-1-ylethanone;2H-tetrazole?
The InChIKey is HIUMOIZANXARLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O.CH2N4/c1-5(8)7-3-2-6-4-7;1-2-4-5-3-1/h2-4H,1H3;1H,(H,2,3,4,5).
What are the key properties of 1-imidazol-1-ylethanone;2H-tetrazole?
1-imidazol-1-ylethanone;2H-tetrazole has a molecular weight of 180.17 g/mol, XLogP of -0.26, 0 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-imidazol-1-ylethanone;2H-tetrazole is sourced from PubChem (CID 142181644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).