C14H15NO3S — CID 10778908
trans-(1S,2S)-1-benzamido-2-prop-2-enylsulfanylcyclopropane-1-carboxylic acid (PubChem CID 10778908) has the molecular formula C14H15NO3S and a molecular weight of 277.34 g/mol. Its IUPAC name is trans-(1S,2S)-1-benzamido-2-prop-2-enylsulfanylcyclopropane-1-carboxylic acid.
| Compound Name | trans-(1S,2S)-1-benzamido-2-prop-2-enylsulfanylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 10778908 |
| Molecular Formula | C14H15NO3S |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | trans-(1S,2S)-1-benzamido-2-prop-2-enylsulfanylcyclopropane-1-carboxylic acid |
| SMILES | C=CCS[C@H]1C[C@]1(NC(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C14H15NO3S/c1-2-8-19-11-9-14(11,13(17)18)15-12(16)10-6-4-3-5-7-10/h2-7,11H,1,8-9H2,(H,15,16)(H,17,18)/t11-,14+/m0/s1 |
| InChIKey | IXVBIIUWQHSSMV-SMDDNHRTSA-N |
| XLogP | 1.93 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|