C20H28O5Si — CID 101021977
trans-dimethyl (3S,4R)-3-[dimethyl(phenyl)silyl]oxy-4-prop-2-enylcyclopentane-1,1-dicarboxylate (PubChem CID 101021977) has the molecular formula C20H28O5Si and a molecular weight of 376.53 g/mol. Its IUPAC name is trans-dimethyl (3S,4R)-3-[dimethyl(phenyl)silyl]oxy-4-prop-2-enylcyclopentane-1,1-dicarboxylate.
| Compound Name | trans-dimethyl (3S,4R)-3-[dimethyl(phenyl)silyl]oxy-4-prop-2-enylcyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 101021977 |
| Molecular Formula | C20H28O5Si |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | trans-dimethyl (3S,4R)-3-[dimethyl(phenyl)silyl]oxy-4-prop-2-enylcyclopentane-1,1-dicarboxylate |
| SMILES | C=CC[C@@H]1CC(C(=O)OC)(C(=O)OC)C[C@@H]1O[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C20H28O5Si/c1-6-10-15-13-20(18(21)23-2,19(22)24-3)14-17(15)25-26(4,5)16-11-8-7-9-12-16/h6-9,11-12,15,17H,1,10,13-14H2,2-5H3/t15-,17+/m1/s1 |
| InChIKey | FCDCXFCMYNHAPE-WBVHZDCISA-N |
| XLogP | 2.80 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|