C18H24INO4 — CID 102056475
dimethyl (4R)-3-[(benzylamino)methyl]-4-(iodomethyl)cyclopentane-1,1-dicarboxylate (PubChem CID 102056475) has the molecular formula C18H24INO4 and a molecular weight of 445.30 g/mol. Its IUPAC name is dimethyl (4R)-3-[(benzylamino)methyl]-4-(iodomethyl)cyclopentane-1,1-dicarboxylate.
| Compound Name | dimethyl (4R)-3-[(benzylamino)methyl]-4-(iodomethyl)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 102056475 |
| Molecular Formula | C18H24INO4 |
| Molecular Weight | 445.30 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | dimethyl (4R)-3-[(benzylamino)methyl]-4-(iodomethyl)cyclopentane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC(CNCc2ccccc2)[C@H](CI)C1 |
| InChI | InChI=1S/C18H24INO4/c1-23-16(21)18(17(22)24-2)8-14(10-19)15(9-18)12-20-11-13-6-4-3-5-7-13/h3-7,14-15,20H,8-12H2,1-2H3/t14-,15?/m0/s1 |
| InChIKey | RSYZSMWQTGQJFO-MLCCFXAWSA-N |
| XLogP | 2.57 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|