C14H25IO4Si — CID 101176905
cis-dimethyl (3S,4R)-3-(iodomethyl)-4-(trimethylsilylmethyl)cyclopentane-1,1-dicarboxylate (PubChem CID 101176905) has the molecular formula C14H25IO4Si and a molecular weight of 412.34 g/mol. Its IUPAC name is cis-dimethyl (3S,4R)-3-(iodomethyl)-4-(trimethylsilylmethyl)cyclopentane-1,1-dicarboxylate.
| Compound Name | cis-dimethyl (3S,4R)-3-(iodomethyl)-4-(trimethylsilylmethyl)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 101176905 |
| Molecular Formula | C14H25IO4Si |
| Molecular Weight | 412.34 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | cis-dimethyl (3S,4R)-3-(iodomethyl)-4-(trimethylsilylmethyl)cyclopentane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@H](CI)[C@H](C[Si](C)(C)C)C1 |
| InChI | InChI=1S/C14H25IO4Si/c1-18-12(16)14(13(17)19-2)6-10(8-15)11(7-14)9-20(3,4)5/h10-11H,6-9H2,1-5H3/t10-,11+/m1/s1 |
| InChIKey | XWAVAYOEACOROX-MNOVXSKESA-N |
| XLogP | 3.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|