C12H17IO5 — CID 101176900
dimethyl (3aR,6S,6aR)-6-(iodomethyl)-2,3,3a,5,6,6a-hexahydrocyclopenta[b]furan-4,4-dicarboxylate (PubChem CID 101176900) has the molecular formula C12H17IO5 and a molecular weight of 368.17 g/mol. Its IUPAC name is dimethyl (3aR,6S,6aR)-6-(iodomethyl)-2,3,3a,5,6,6a-hexahydrocyclopenta[b]furan-4,4-dicarboxylate.
| Compound Name | dimethyl (3aR,6S,6aR)-6-(iodomethyl)-2,3,3a,5,6,6a-hexahydrocyclopenta[b]furan-4,4-dicarboxylate |
|---|---|
| PubChem CID | 101176900 |
| Molecular Formula | C12H17IO5 |
| Molecular Weight | 368.17 g/mol |
| Exact Mass | 368.01 |
| IUPAC Name | dimethyl (3aR,6S,6aR)-6-(iodomethyl)-2,3,3a,5,6,6a-hexahydrocyclopenta[b]furan-4,4-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@H](CI)[C@@H]2OCC[C@@H]21 |
| InChI | InChI=1S/C12H17IO5/c1-16-10(14)12(11(15)17-2)5-7(6-13)9-8(12)3-4-18-9/h7-9H,3-6H2,1-2H3/t7-,8+,9+/m1/s1 |
| InChIKey | BJCGONMONNXVKV-VGMNWLOBSA-N |
| XLogP | 1.18 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.17 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|