C22H32O4Si — CID 10572379
dimethyl (3S,3aS,7aR)-3-[[dimethyl(phenyl)silyl]methyl]-2,3,3a,4,5,6,7,7a-octahydroindene-1,1-dicarboxylate (PubChem CID 10572379) has the molecular formula C22H32O4Si and a molecular weight of 388.58 g/mol. Its IUPAC name is dimethyl (3S,3aS,7aR)-3-[[dimethyl(phenyl)silyl]methyl]-2,3,3a,4,5,6,7,7a-octahydroindene-1,1-dicarboxylate.
| Compound Name | dimethyl (3S,3aS,7aR)-3-[[dimethyl(phenyl)silyl]methyl]-2,3,3a,4,5,6,7,7a-octahydroindene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 10572379 |
| Molecular Formula | C22H32O4Si |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | dimethyl (3S,3aS,7aR)-3-[[dimethyl(phenyl)silyl]methyl]-2,3,3a,4,5,6,7,7a-octahydroindene-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@H](C[Si](C)(C)c2ccccc2)[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C22H32O4Si/c1-25-20(23)22(21(24)26-2)14-16(18-12-8-9-13-19(18)22)15-27(3,4)17-10-6-5-7-11-17/h5-7,10-11,16,18-19H,8-9,12-15H2,1-4H3/t16-,18-,19-/m1/s1 |
| InChIKey | SFHPDOITQDLIHZ-BHIYHBOVSA-N |
| XLogP | 3.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|