C27H31NO3Si — CID 134848092
cis-methyl (1R,2S)-2-[[tert-butyl(diphenyl)silyl]methyl]-1-(pyrrole-1-carbonyl)cyclopropane-1-carboxylate (PubChem CID 134848092) has the molecular formula C27H31NO3Si and a molecular weight of 445.64 g/mol. Its IUPAC name is cis-methyl (1R,2S)-2-[[tert-butyl(diphenyl)silyl]methyl]-1-(pyrrole-1-carbonyl)cyclopropane-1-carboxylate.
| Compound Name | cis-methyl (1R,2S)-2-[[tert-butyl(diphenyl)silyl]methyl]-1-(pyrrole-1-carbonyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 134848092 |
| Molecular Formula | C27H31NO3Si |
| Molecular Weight | 445.64 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | cis-methyl (1R,2S)-2-[[tert-butyl(diphenyl)silyl]methyl]-1-(pyrrole-1-carbonyl)cyclopropane-1-carboxylate |
| SMILES | COC(=O)[C@]1(C(=O)n2cccc2)C[C@@H]1C[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H31NO3Si/c1-26(2,3)32(22-13-7-5-8-14-22,23-15-9-6-10-16-23)20-21-19-27(21,25(30)31-4)24(29)28-17-11-12-18-28/h5-18,21H,19-20H2,1-4H3/t21-,27-/m1/s1 |
| InChIKey | FOZCPLAMGXOVEM-JIPXPUAJSA-N |
| XLogP | 4.37 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.64 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|