C19H24O4S — CID 134980596
dimethyl (3aS,6aR)-3-(phenylsulfanylmethyl)-3,3a,4,5,6,6a-hexahydro-2H-pentalene-1,1-dicarboxylate (PubChem CID 134980596) has the molecular formula C19H24O4S and a molecular weight of 348.46 g/mol. Its IUPAC name is dimethyl (3aS,6aR)-3-(phenylsulfanylmethyl)-3,3a,4,5,6,6a-hexahydro-2H-pentalene-1,1-dicarboxylate.
| Compound Name | dimethyl (3aS,6aR)-3-(phenylsulfanylmethyl)-3,3a,4,5,6,6a-hexahydro-2H-pentalene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 134980596 |
| Molecular Formula | C19H24O4S |
| Molecular Weight | 348.46 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | dimethyl (3aS,6aR)-3-(phenylsulfanylmethyl)-3,3a,4,5,6,6a-hexahydro-2H-pentalene-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC(CSc2ccccc2)[C@H]2CCC[C@H]21 |
| InChI | InChI=1S/C19H24O4S/c1-22-17(20)19(18(21)23-2)11-13(15-9-6-10-16(15)19)12-24-14-7-4-3-5-8-14/h3-5,7-8,13,15-16H,6,9-12H2,1-2H3/t13?,15-,16-/m1/s1 |
| InChIKey | ZJFCDDOZFIVRFN-GNHXQJIDSA-N |
| XLogP | 3.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|