C20H27NO4S — CID 101436947
dimethyl (1S,9aS)-1-(phenylsulfanylmethyl)-1,2,5,6,7,8,9,9a-octahydropyrrolo[1,2-a]azepine-3,3-dicarboxylate (PubChem CID 101436947) has the molecular formula C20H27NO4S and a molecular weight of 377.51 g/mol. Its IUPAC name is dimethyl (1S,9aS)-1-(phenylsulfanylmethyl)-1,2,5,6,7,8,9,9a-octahydropyrrolo[1,2-a]azepine-3,3-dicarboxylate.
| Compound Name | dimethyl (1S,9aS)-1-(phenylsulfanylmethyl)-1,2,5,6,7,8,9,9a-octahydropyrrolo[1,2-a]azepine-3,3-dicarboxylate |
|---|---|
| PubChem CID | 101436947 |
| Molecular Formula | C20H27NO4S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | dimethyl (1S,9aS)-1-(phenylsulfanylmethyl)-1,2,5,6,7,8,9,9a-octahydropyrrolo[1,2-a]azepine-3,3-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@H](CSc2ccccc2)[C@@H]2CCCCCN21 |
| InChI | InChI=1S/C20H27NO4S/c1-24-18(22)20(19(23)25-2)13-15(14-26-16-9-5-3-6-10-16)17-11-7-4-8-12-21(17)20/h3,5-6,9-10,15,17H,4,7-8,11-14H2,1-2H3/t15-,17+/m1/s1 |
| InChIKey | QZJPOYXCMPYNIJ-WBVHZDCISA-N |
| XLogP | 3.13 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|