C20H29NO3 — CID 154198152
methyl 4-hydroxy-1-phenyl-3-(piperidin-1-ylmethyl)cyclohexane-1-carboxylate (PubChem CID 154198152) has the molecular formula C20H29NO3 and a molecular weight of 331.46 g/mol. Its IUPAC name is methyl 4-hydroxy-1-phenyl-3-(piperidin-1-ylmethyl)cyclohexane-1-carboxylate.
| Compound Name | methyl 4-hydroxy-1-phenyl-3-(piperidin-1-ylmethyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 154198152 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | methyl 4-hydroxy-1-phenyl-3-(piperidin-1-ylmethyl)cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1(c2ccccc2)CCC(O)C(CN2CCCCC2)C1 |
| InChI | InChI=1S/C20H29NO3/c1-24-19(23)20(17-8-4-2-5-9-17)11-10-18(22)16(14-20)15-21-12-6-3-7-13-21/h2,4-5,8-9,16,18,22H,3,6-7,10-15H2,1H3 |
| InChIKey | ODIHOJNDEJOBSY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |