C20H29NO2 — CID 46213709
[(2R)-1-methylpiperidin-2-yl]methyl 1-phenylcyclohexane-1-carboxylate (PubChem CID 46213709) has the molecular formula C20H29NO2 and a molecular weight of 315.46 g/mol. Its IUPAC name is [(2R)-1-methylpiperidin-2-yl]methyl 1-phenylcyclohexane-1-carboxylate.
| Compound Name | [(2R)-1-methylpiperidin-2-yl]methyl 1-phenylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 46213709 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | [(2R)-1-methylpiperidin-2-yl]methyl 1-phenylcyclohexane-1-carboxylate |
| SMILES | CN1CCCC[C@@H]1COC(=O)C1(c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C20H29NO2/c1-21-15-9-6-12-18(21)16-23-19(22)20(13-7-3-8-14-20)17-10-4-2-5-11-17/h2,4-5,10-11,18H,3,6-9,12-16H2,1H3/t18-/m1/s1 |
| InChIKey | DLRMHLDDSOGBCC-GOSISDBHSA-N |
| XLogP | 3.92 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |