C19H26O2 — CID 54206862
cyclohexyl 1-phenylcyclohexane-1-carboxylate (PubChem CID 54206862) has the molecular formula C19H26O2 and a molecular weight of 286.41 g/mol. Its IUPAC name is cyclohexyl 1-phenylcyclohexane-1-carboxylate.
| Compound Name | cyclohexyl 1-phenylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 54206862 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | cyclohexyl 1-phenylcyclohexane-1-carboxylate |
| SMILES | O=C(OC1CCCCC1)C1(c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C19H26O2/c20-18(21-17-12-6-2-7-13-17)19(14-8-3-9-15-19)16-10-4-1-5-11-16/h1,4-5,10-11,17H,2-3,6-9,12-15H2 |
| InChIKey | PTCDBAWVMSFKHP-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |