C19H27NO2 — CID 90705729
piperidin-4-yl 1-phenylcycloheptane-1-carboxylate (PubChem CID 90705729) has the molecular formula C19H27NO2 and a molecular weight of 301.43 g/mol. Its IUPAC name is piperidin-4-yl 1-phenylcycloheptane-1-carboxylate.
| Compound Name | piperidin-4-yl 1-phenylcycloheptane-1-carboxylate |
|---|---|
| PubChem CID | 90705729 |
| Molecular Formula | C19H27NO2 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | piperidin-4-yl 1-phenylcycloheptane-1-carboxylate |
| SMILES | O=C(OC1CCNCC1)C1(c2ccccc2)CCCCCC1 |
| InChI | InChI=1S/C19H27NO2/c21-18(22-17-10-14-20-15-11-17)19(12-6-1-2-7-13-19)16-8-4-3-5-9-16/h3-5,8-9,17,20H,1-2,6-7,10-15H2 |
| InChIKey | DFGJSMBEDNEJAP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |