C19H26FNO2 — CID 46213458
2-(1-methylpyrrolidin-2-yl)ethyl 1-(4-fluorophenyl)cyclopentane-1-carboxylate (PubChem CID 46213458) has the molecular formula C19H26FNO2 and a molecular weight of 319.42 g/mol. Its IUPAC name is 2-(1-methylpyrrolidin-2-yl)ethyl 1-(4-fluorophenyl)cyclopentane-1-carboxylate.
| Compound Name | 2-(1-methylpyrrolidin-2-yl)ethyl 1-(4-fluorophenyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 46213458 |
| Molecular Formula | C19H26FNO2 |
| Molecular Weight | 319.42 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 2-(1-methylpyrrolidin-2-yl)ethyl 1-(4-fluorophenyl)cyclopentane-1-carboxylate |
| SMILES | CN1CCCC1CCOC(=O)C1(c2ccc(F)cc2)CCCC1 |
| InChI | InChI=1S/C19H26FNO2/c1-21-13-4-5-17(21)10-14-23-18(22)19(11-2-3-12-19)15-6-8-16(20)9-7-15/h6-9,17H,2-5,10-14H2,1H3 |
| InChIKey | NPRHOEJKHXDJJM-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.42 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |