C20H24FNO5 — CID 55538522
methyl 1-[2-[1-(4-fluorophenyl)cyclobutanecarbonyl]oxyacetyl]piperidine-4-carboxylate (PubChem CID 55538522) has the molecular formula C20H24FNO5 and a molecular weight of 377.41 g/mol. Its IUPAC name is methyl 1-[2-[1-(4-fluorophenyl)cyclobutanecarbonyl]oxyacetyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[2-[1-(4-fluorophenyl)cyclobutanecarbonyl]oxyacetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 55538522 |
| Molecular Formula | C20H24FNO5 |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | methyl 1-[2-[1-(4-fluorophenyl)cyclobutanecarbonyl]oxyacetyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)COC(=O)C2(c3ccc(F)cc3)CCC2)CC1 |
| InChI | InChI=1S/C20H24FNO5/c1-26-18(24)14-7-11-22(12-8-14)17(23)13-27-19(25)20(9-2-10-20)15-3-5-16(21)6-4-15/h3-6,14H,2,7-13H2,1H3 |
| InChIKey | OPMPXMVOWIMTMM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |