C22H28ClNO5 — CID 55546439
methyl 1-[2-[1-(3-chlorophenyl)cyclohexanecarbonyl]oxyacetyl]piperidine-4-carboxylate (PubChem CID 55546439) has the molecular formula C22H28ClNO5 and a molecular weight of 421.92 g/mol. Its IUPAC name is methyl 1-[2-[1-(3-chlorophenyl)cyclohexanecarbonyl]oxyacetyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[2-[1-(3-chlorophenyl)cyclohexanecarbonyl]oxyacetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 55546439 |
| Molecular Formula | C22H28ClNO5 |
| Molecular Weight | 421.92 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | methyl 1-[2-[1-(3-chlorophenyl)cyclohexanecarbonyl]oxyacetyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)COC(=O)C2(c3cccc(Cl)c3)CCCCC2)CC1 |
| InChI | InChI=1S/C22H28ClNO5/c1-28-20(26)16-8-12-24(13-9-16)19(25)15-29-21(27)22(10-3-2-4-11-22)17-6-5-7-18(23)14-17/h5-7,14,16H,2-4,8-13,15H2,1H3 |
| InChIKey | IJAYDRXOYAHKGV-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.92 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |