C18H23NO4 — CID 29362626
methyl 1-[(2R)-oxolane-2-carbonyl]-4-phenylpiperidine-4-carboxylate (PubChem CID 29362626) has the molecular formula C18H23NO4 and a molecular weight of 317.38 g/mol. Its IUPAC name is methyl 1-[(2R)-oxolane-2-carbonyl]-4-phenylpiperidine-4-carboxylate.
| Compound Name | methyl 1-[(2R)-oxolane-2-carbonyl]-4-phenylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 29362626 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | methyl 1-[(2R)-oxolane-2-carbonyl]-4-phenylpiperidine-4-carboxylate |
| SMILES | COC(=O)C1(c2ccccc2)CCN(C(=O)[C@H]2CCCO2)CC1 |
| InChI | InChI=1S/C18H23NO4/c1-22-17(21)18(14-6-3-2-4-7-14)9-11-19(12-10-18)16(20)15-8-5-13-23-15/h2-4,6-7,15H,5,8-13H2,1H3/t15-/m1/s1 |
| InChIKey | VYNLDEOHAQEQFS-OAHLLOKOSA-N |
| XLogP | 1.90 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |