C18H23NO5 — CID 56889702
4-(2-methylphenoxy)-1-(oxolane-2-carbonyl)piperidine-4-carboxylic acid (PubChem CID 56889702) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is 4-(2-methylphenoxy)-1-(oxolane-2-carbonyl)piperidine-4-carboxylic acid.
| Compound Name | 4-(2-methylphenoxy)-1-(oxolane-2-carbonyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 56889702 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 4-(2-methylphenoxy)-1-(oxolane-2-carbonyl)piperidine-4-carboxylic acid |
| SMILES | Cc1ccccc1OC1(C(=O)O)CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C18H23NO5/c1-13-5-2-3-6-14(13)24-18(17(21)22)8-10-19(11-9-18)16(20)15-7-4-12-23-15/h2-3,5-6,15H,4,7-12H2,1H3,(H,21,22) |
| InChIKey | RGBXSPDQFFSKGL-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |