C22H28N2O3 — CID 86839651
methyl 4-phenyl-1-(1-prop-2-ynylpiperidine-4-carbonyl)piperidine-4-carboxylate (PubChem CID 86839651) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is methyl 4-phenyl-1-(1-prop-2-ynylpiperidine-4-carbonyl)piperidine-4-carboxylate.
| Compound Name | methyl 4-phenyl-1-(1-prop-2-ynylpiperidine-4-carbonyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 86839651 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | methyl 4-phenyl-1-(1-prop-2-ynylpiperidine-4-carbonyl)piperidine-4-carboxylate |
| SMILES | C#CCN1CCC(C(=O)N2CCC(C(=O)OC)(c3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C22H28N2O3/c1-3-13-23-14-9-18(10-15-23)20(25)24-16-11-22(12-17-24,21(26)27-2)19-7-5-4-6-8-19/h1,4-8,18H,9-17H2,2H3 |
| InChIKey | CRUZQHVWEOAWHZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|