C23H28O4 — CID 135007170
dimethyl (1R,5R,6R)-1-[(1R,6S)-7-bicyclo[4.1.0]heptanyl]-6-phenylbicyclo[3.1.0]hexane-3,3-dicarboxylate (PubChem CID 135007170) has the molecular formula C23H28O4 and a molecular weight of 368.47 g/mol. Its IUPAC name is dimethyl (1R,5R,6R)-1-[(1R,6S)-7-bicyclo[4.1.0]heptanyl]-6-phenylbicyclo[3.1.0]hexane-3,3-dicarboxylate.
| Compound Name | dimethyl (1R,5R,6R)-1-[(1R,6S)-7-bicyclo[4.1.0]heptanyl]-6-phenylbicyclo[3.1.0]hexane-3,3-dicarboxylate |
|---|---|
| PubChem CID | 135007170 |
| Molecular Formula | C23H28O4 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | dimethyl (1R,5R,6R)-1-[(1R,6S)-7-bicyclo[4.1.0]heptanyl]-6-phenylbicyclo[3.1.0]hexane-3,3-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@@H]2[C@H](c3ccccc3)[C@]2(C2[C@H]3CCCC[C@@H]23)C1 |
| InChI | InChI=1S/C23H28O4/c1-26-20(24)22(21(25)27-2)12-17-18(14-8-4-3-5-9-14)23(17,13-22)19-15-10-6-7-11-16(15)19/h3-5,8-9,15-19H,6-7,10-13H2,1-2H3/t15-,16+,17-,18+,19?,23+/m1/s1 |
| InChIKey | FZNVSFTYIQQGID-BOBSSARTSA-N |
| XLogP | 3.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|