C25H26O4 — CID 135007316
dimethyl (1S,5S,6R)-6-phenyl-1-[(1R,2R)-2-phenylcyclopropyl]bicyclo[3.1.0]hexane-3,3-dicarboxylate (PubChem CID 135007316) has the molecular formula C25H26O4 and a molecular weight of 390.48 g/mol. Its IUPAC name is dimethyl (1S,5S,6R)-6-phenyl-1-[(1R,2R)-2-phenylcyclopropyl]bicyclo[3.1.0]hexane-3,3-dicarboxylate.
| Compound Name | dimethyl (1S,5S,6R)-6-phenyl-1-[(1R,2R)-2-phenylcyclopropyl]bicyclo[3.1.0]hexane-3,3-dicarboxylate |
|---|---|
| PubChem CID | 135007316 |
| Molecular Formula | C25H26O4 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | dimethyl (1S,5S,6R)-6-phenyl-1-[(1R,2R)-2-phenylcyclopropyl]bicyclo[3.1.0]hexane-3,3-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@H]2[C@H](c3ccccc3)[C@@]2([C@@H]2C[C@H]2c2ccccc2)C1 |
| InChI | InChI=1S/C25H26O4/c1-28-22(26)24(23(27)29-2)14-20-21(17-11-7-4-8-12-17)25(20,15-24)19-13-18(19)16-9-5-3-6-10-16/h3-12,18-21H,13-15H2,1-2H3/t18-,19+,20-,21-,25+/m0/s1 |
| InChIKey | LNZTVFCVDILLBC-QQQKFWQGSA-N |
| XLogP | 4.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|