C22H23NO7 — CID 154713554
dimethyl (2R,3S,4S,6S)-6-hydroxy-3-nitro-2,4-diphenylcyclohexane-1,1-dicarboxylate (PubChem CID 154713554) has the molecular formula C22H23NO7 and a molecular weight of 413.43 g/mol. Its IUPAC name is dimethyl (2R,3S,4S,6S)-6-hydroxy-3-nitro-2,4-diphenylcyclohexane-1,1-dicarboxylate.
| Compound Name | dimethyl (2R,3S,4S,6S)-6-hydroxy-3-nitro-2,4-diphenylcyclohexane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 154713554 |
| Molecular Formula | C22H23NO7 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | dimethyl (2R,3S,4S,6S)-6-hydroxy-3-nitro-2,4-diphenylcyclohexane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)[C@@H](O)C[C@@H](c2ccccc2)[C@H]([N+](=O)[O-])[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C22H23NO7/c1-29-20(25)22(21(26)30-2)17(24)13-16(14-9-5-3-6-10-14)19(23(27)28)18(22)15-11-7-4-8-12-15/h3-12,16-19,24H,13H2,1-2H3/t16-,17-,18-,19-/m0/s1 |
| InChIKey | LWCXJNOKERYCNK-VJANTYMQSA-N |
| XLogP | 2.30 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|