C17H15NO6 — CID 101418219
cis-dimethyl (2R,3S)-2-naphthalen-1-yl-3-nitrocyclopropane-1,1-dicarboxylate (PubChem CID 101418219) has the molecular formula C17H15NO6 and a molecular weight of 329.31 g/mol. Its IUPAC name is cis-dimethyl (2R,3S)-2-naphthalen-1-yl-3-nitrocyclopropane-1,1-dicarboxylate.
| Compound Name | cis-dimethyl (2R,3S)-2-naphthalen-1-yl-3-nitrocyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 101418219 |
| Molecular Formula | C17H15NO6 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | cis-dimethyl (2R,3S)-2-naphthalen-1-yl-3-nitrocyclopropane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)[C@@H]([N+](=O)[O-])[C@@H]1c1cccc2ccccc12 |
| InChI | InChI=1S/C17H15NO6/c1-23-15(19)17(16(20)24-2)13(14(17)18(21)22)12-9-5-7-10-6-3-4-8-11(10)12/h3-9,13-14H,1-2H3/t13-,14-/m0/s1 |
| InChIKey | YOVXIHNJGHBMHM-KBPBESRZSA-N |
| XLogP | 1.91 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|