C24H24N2O4 — CID 169096892
methyl (2S,3R,4S,5S)-2,4-dimethyl-5-naphthalen-1-yl-4-nitro-3-phenylpyrrolidine-2-carboxylate (PubChem CID 169096892) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is methyl (2S,3R,4S,5S)-2,4-dimethyl-5-naphthalen-1-yl-4-nitro-3-phenylpyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,3R,4S,5S)-2,4-dimethyl-5-naphthalen-1-yl-4-nitro-3-phenylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 169096892 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | methyl (2S,3R,4S,5S)-2,4-dimethyl-5-naphthalen-1-yl-4-nitro-3-phenylpyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@]1(C)N[C@@H](c2cccc3ccccc23)[C@@](C)([N+](=O)[O-])[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C24H24N2O4/c1-23(22(27)30-3)20(17-11-5-4-6-12-17)24(2,26(28)29)21(25-23)19-15-9-13-16-10-7-8-14-18(16)19/h4-15,20-21,25H,1-3H3/t20-,21+,23+,24+/m1/s1 |
| InChIKey | OSGJCGOFVZTIJP-KJBBBAAKSA-N |
| XLogP | 4.24 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|