C26H20N2O4 — CID 101168615
1-[(1S,2R)-2-[(1R,2S)-2-naphthalen-1-yl-1-nitrocyclopropyl]-2-nitrocyclopropyl]naphthalene (PubChem CID 101168615) has the molecular formula C26H20N2O4 and a molecular weight of 424.46 g/mol. Its IUPAC name is 1-[(1S,2R)-2-[(1R,2S)-2-naphthalen-1-yl-1-nitrocyclopropyl]-2-nitrocyclopropyl]naphthalene.
| Compound Name | 1-[(1S,2R)-2-[(1R,2S)-2-naphthalen-1-yl-1-nitrocyclopropyl]-2-nitrocyclopropyl]naphthalene |
|---|---|
| PubChem CID | 101168615 |
| Molecular Formula | C26H20N2O4 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 1-[(1S,2R)-2-[(1R,2S)-2-naphthalen-1-yl-1-nitrocyclopropyl]-2-nitrocyclopropyl]naphthalene |
| SMILES | O=[N+]([O-])[C@]1([C@@]2([N+](=O)[O-])C[C@H]2c2cccc3ccccc23)C[C@H]1c1cccc2ccccc12 |
| InChI | InChI=1S/C26H20N2O4/c29-27(30)25(15-23(25)21-13-5-9-17-7-1-3-11-19(17)21)26(28(31)32)16-24(26)22-14-6-10-18-8-2-4-12-20(18)22/h1-14,23-24H,15-16H2/t23-,24-,25+,26+/m0/s1 |
| InChIKey | RUQUGSKTRIPWTL-QEGGNFSNSA-N |
| XLogP | 5.70 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|